C20H19N5O5S — CID 39901705
N-benzyl-3-[[[2-(2-oxopyrimidin-1-yl)acetyl]amino]carbamoyl]benzenesulfonamide (PubChem CID 39901705) has the molecular formula C20H19N5O5S and a molecular weight of 441.47 g/mol. Its IUPAC name is N-benzyl-3-[[[2-(2-oxopyrimidin-1-yl)acetyl]amino]carbamoyl]benzenesulfonamide.
| Compound Name | N-benzyl-3-[[[2-(2-oxopyrimidin-1-yl)acetyl]amino]carbamoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 39901705 |
| Molecular Formula | C20H19N5O5S |
| Molecular Weight | 441.47 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | N-benzyl-3-[[[2-(2-oxopyrimidin-1-yl)acetyl]amino]carbamoyl]benzenesulfonamide |
| SMILES | O=C(Cn1cccnc1=O)NNC(=O)c1cccc(S(=O)(=O)NCc2ccccc2)c1 |
| InChI | InChI=1S/C20H19N5O5S/c26-18(14-25-11-5-10-21-20(25)28)23-24-19(27)16-8-4-9-17(12-16)31(29,30)22-13-15-6-2-1-3-7-15/h1-12,22H,13-14H2,(H,23,26)(H,24,27) |
| InChIKey | UGFPZYPZCFYFJI-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 139.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.47 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|