C21H18N4O4S — CID 17430765
N-[4-(furan-2-ylmethylsulfamoyl)phenyl]-3-phenyl-1H-pyrazole-5-carboxamide (PubChem CID 17430765) has the molecular formula C21H18N4O4S and a molecular weight of 422.47 g/mol. Its IUPAC name is N-[4-(furan-2-ylmethylsulfamoyl)phenyl]-3-phenyl-1H-pyrazole-5-carboxamide.
| Compound Name | N-[4-(furan-2-ylmethylsulfamoyl)phenyl]-3-phenyl-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 17430765 |
| Molecular Formula | C21H18N4O4S |
| Molecular Weight | 422.47 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | N-[4-(furan-2-ylmethylsulfamoyl)phenyl]-3-phenyl-1H-pyrazole-5-carboxamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)NCc2ccco2)cc1)c1cc(-c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C21H18N4O4S/c26-21(20-13-19(24-25-20)15-5-2-1-3-6-15)23-16-8-10-18(11-9-16)30(27,28)22-14-17-7-4-12-29-17/h1-13,22H,14H2,(H,23,26)(H,24,25) |
| InChIKey | XRJGYJJWXFDOCI-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 117.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.47 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |