C21H17N3O4S2 — CID 17404485
4-(furan-2-ylmethylsulfamoyl)-N-(4-phenyl-1,3-thiazol-2-yl)benzamide (PubChem CID 17404485) has the molecular formula C21H17N3O4S2 and a molecular weight of 439.52 g/mol. Its IUPAC name is 4-(furan-2-ylmethylsulfamoyl)-N-(4-phenyl-1,3-thiazol-2-yl)benzamide.
| Compound Name | 4-(furan-2-ylmethylsulfamoyl)-N-(4-phenyl-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 17404485 |
| Molecular Formula | C21H17N3O4S2 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.07 |
| IUPAC Name | 4-(furan-2-ylmethylsulfamoyl)-N-(4-phenyl-1,3-thiazol-2-yl)benzamide |
| SMILES | O=C(Nc1nc(-c2ccccc2)cs1)c1ccc(S(=O)(=O)NCc2ccco2)cc1 |
| InChI | InChI=1S/C21H17N3O4S2/c25-20(24-21-23-19(14-29-21)15-5-2-1-3-6-15)16-8-10-18(11-9-16)30(26,27)22-13-17-7-4-12-28-17/h1-12,14,22H,13H2,(H,23,24,25) |
| InChIKey | BGFDZGCLYCERFM-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |