C33H25N3O4S — CID 2422470
N-[4-(furan-2-ylmethylsulfamoyl)phenyl]-2-(4-phenylphenyl)quinoline-4-carboxamide (PubChem CID 2422470) has the molecular formula C33H25N3O4S and a molecular weight of 559.65 g/mol. Its IUPAC name is N-[4-(furan-2-ylmethylsulfamoyl)phenyl]-2-(4-phenylphenyl)quinoline-4-carboxamide.
| Compound Name | N-[4-(furan-2-ylmethylsulfamoyl)phenyl]-2-(4-phenylphenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 2422470 |
| Molecular Formula | C33H25N3O4S |
| Molecular Weight | 559.65 g/mol |
| Exact Mass | 559.16 |
| IUPAC Name | N-[4-(furan-2-ylmethylsulfamoyl)phenyl]-2-(4-phenylphenyl)quinoline-4-carboxamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)NCc2ccco2)cc1)c1cc(-c2ccc(-c3ccccc3)cc2)nc2ccccc12 |
| InChI | InChI=1S/C33H25N3O4S/c37-33(35-26-16-18-28(19-17-26)41(38,39)34-22-27-9-6-20-40-27)30-21-32(36-31-11-5-4-10-29(30)31)25-14-12-24(13-15-25)23-7-2-1-3-8-23/h1-21,34H,22H2,(H,35,37) |
| InChIKey | ZPSAEPHQUQEMEX-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.65 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |