C23H17F3N4O3S — CID 25469665
2-pyridin-4-yl-N-[4-(2,2,2-trifluoroethylsulfamoyl)phenyl]quinoline-4-carboxamide (PubChem CID 25469665) has the molecular formula C23H17F3N4O3S and a molecular weight of 486.48 g/mol. Its IUPAC name is 2-pyridin-4-yl-N-[4-(2,2,2-trifluoroethylsulfamoyl)phenyl]quinoline-4-carboxamide.
| Compound Name | 2-pyridin-4-yl-N-[4-(2,2,2-trifluoroethylsulfamoyl)phenyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 25469665 |
| Molecular Formula | C23H17F3N4O3S |
| Molecular Weight | 486.48 g/mol |
| Exact Mass | 486.10 |
| IUPAC Name | 2-pyridin-4-yl-N-[4-(2,2,2-trifluoroethylsulfamoyl)phenyl]quinoline-4-carboxamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)NCC(F)(F)F)cc1)c1cc(-c2ccncc2)nc2ccccc12 |
| InChI | InChI=1S/C23H17F3N4O3S/c24-23(25,26)14-28-34(32,33)17-7-5-16(6-8-17)29-22(31)19-13-21(15-9-11-27-12-10-15)30-20-4-2-1-3-18(19)20/h1-13,28H,14H2,(H,29,31) |
| InChIKey | AQZMXRSMCRPFQF-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.48 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |