C27H21N5O3S — CID 1292635
2-(4-methylphenyl)-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]quinoline-4-carboxamide (PubChem CID 1292635) has the molecular formula C27H21N5O3S and a molecular weight of 495.56 g/mol. Its IUPAC name is 2-(4-methylphenyl)-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]quinoline-4-carboxamide.
| Compound Name | 2-(4-methylphenyl)-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 1292635 |
| Molecular Formula | C27H21N5O3S |
| Molecular Weight | 495.56 g/mol |
| Exact Mass | 495.14 |
| IUPAC Name | 2-(4-methylphenyl)-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]quinoline-4-carboxamide |
| SMILES | Cc1ccc(-c2cc(C(=O)Nc3ccc(S(=O)(=O)Nc4ncccn4)cc3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C27H21N5O3S/c1-18-7-9-19(10-8-18)25-17-23(22-5-2-3-6-24(22)31-25)26(33)30-20-11-13-21(14-12-20)36(34,35)32-27-28-15-4-16-29-27/h2-17H,1H3,(H,30,33)(H,28,29,32) |
| InChIKey | YDWYMPLCOUYNKF-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 113.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.56 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |