C25H21N7O3S — CID 19518582
2-(1-ethylpyrazol-4-yl)-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]quinoline-4-carboxamide (PubChem CID 19518582) has the molecular formula C25H21N7O3S and a molecular weight of 499.56 g/mol. Its IUPAC name is 2-(1-ethylpyrazol-4-yl)-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]quinoline-4-carboxamide.
| Compound Name | 2-(1-ethylpyrazol-4-yl)-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 19518582 |
| Molecular Formula | C25H21N7O3S |
| Molecular Weight | 499.56 g/mol |
| Exact Mass | 499.14 |
| IUPAC Name | 2-(1-ethylpyrazol-4-yl)-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]quinoline-4-carboxamide |
| SMILES | CCn1cc(-c2cc(C(=O)Nc3ccc(S(=O)(=O)Nc4ncccn4)cc3)c3ccccc3n2)cn1 |
| InChI | InChI=1S/C25H21N7O3S/c1-2-32-16-17(15-28-32)23-14-21(20-6-3-4-7-22(20)30-23)24(33)29-18-8-10-19(11-9-18)36(34,35)31-25-26-12-5-13-27-25/h3-16H,2H2,1H3,(H,29,33)(H,26,27,31) |
| InChIKey | JASCDCYNBXIPOJ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 131.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.56 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |