C21H18N6O3S — CID 19510274
3-(4-methylphenyl)-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]-1H-pyrazole-5-carboxamide (PubChem CID 19510274) has the molecular formula C21H18N6O3S and a molecular weight of 434.48 g/mol. Its IUPAC name is 3-(4-methylphenyl)-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]-1H-pyrazole-5-carboxamide.
| Compound Name | 3-(4-methylphenyl)-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19510274 |
| Molecular Formula | C21H18N6O3S |
| Molecular Weight | 434.48 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | 3-(4-methylphenyl)-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]-1H-pyrazole-5-carboxamide |
| SMILES | Cc1ccc(-c2cc(C(=O)Nc3ccc(S(=O)(=O)Nc4ncccn4)cc3)[nH]n2)cc1 |
| InChI | InChI=1S/C21H18N6O3S/c1-14-3-5-15(6-4-14)18-13-19(26-25-18)20(28)24-16-7-9-17(10-8-16)31(29,30)27-21-22-11-2-12-23-21/h2-13H,1H3,(H,24,28)(H,25,26)(H,22,23,27) |
| InChIKey | IAJYOASXPVDDRP-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 129.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.48 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |