C25H23N5O5S2 — CID 43886795
2-[methyl-(4-methylphenyl)sulfonylamino]-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]benzamide (PubChem CID 43886795) has the molecular formula C25H23N5O5S2 and a molecular weight of 537.62 g/mol. Its IUPAC name is 2-[methyl-(4-methylphenyl)sulfonylamino]-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]benzamide.
| Compound Name | 2-[methyl-(4-methylphenyl)sulfonylamino]-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 43886795 |
| Molecular Formula | C25H23N5O5S2 |
| Molecular Weight | 537.62 g/mol |
| Exact Mass | 537.11 |
| IUPAC Name | 2-[methyl-(4-methylphenyl)sulfonylamino]-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]benzamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)c2ccccc2C(=O)Nc2ccc(S(=O)(=O)Nc3ncccn3)cc2)cc1 |
| InChI | InChI=1S/C25H23N5O5S2/c1-18-8-12-21(13-9-18)37(34,35)30(2)23-7-4-3-6-22(23)24(31)28-19-10-14-20(15-11-19)36(32,33)29-25-26-16-5-17-27-25/h3-17H,1-2H3,(H,28,31)(H,26,27,29) |
| InChIKey | MLXLHOHVLWFUHK-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 138.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.62 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |