C16H14N4O — CID 19510252
3-(4-methylphenyl)-N-pyridin-4-yl-1H-pyrazole-5-carboxamide (PubChem CID 19510252) has the molecular formula C16H14N4O and a molecular weight of 278.31 g/mol. Its IUPAC name is 3-(4-methylphenyl)-N-pyridin-4-yl-1H-pyrazole-5-carboxamide.
| Compound Name | 3-(4-methylphenyl)-N-pyridin-4-yl-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19510252 |
| Molecular Formula | C16H14N4O |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 3-(4-methylphenyl)-N-pyridin-4-yl-1H-pyrazole-5-carboxamide |
| SMILES | Cc1ccc(-c2cc(C(=O)Nc3ccncc3)[nH]n2)cc1 |
| InChI | InChI=1S/C16H14N4O/c1-11-2-4-12(5-3-11)14-10-15(20-19-14)16(21)18-13-6-8-17-9-7-13/h2-10H,1H3,(H,19,20)(H,17,18,21) |
| InChIKey | AQESUKMDWXLVFO-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |