C22H24N4O4 — CID 8889507
N'-(4-butoxy-3-methoxybenzoyl)-3-phenyl-1H-pyrazole-5-carbohydrazide (PubChem CID 8889507) has the molecular formula C22H24N4O4 and a molecular weight of 408.46 g/mol. Its IUPAC name is N'-(4-butoxy-3-methoxybenzoyl)-3-phenyl-1H-pyrazole-5-carbohydrazide.
| Compound Name | N'-(4-butoxy-3-methoxybenzoyl)-3-phenyl-1H-pyrazole-5-carbohydrazide |
|---|---|
| PubChem CID | 8889507 |
| Molecular Formula | C22H24N4O4 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | N'-(4-butoxy-3-methoxybenzoyl)-3-phenyl-1H-pyrazole-5-carbohydrazide |
| SMILES | CCCCOc1ccc(C(=O)NNC(=O)c2cc(-c3ccccc3)n[nH]2)cc1OC |
| InChI | InChI=1S/C22H24N4O4/c1-3-4-12-30-19-11-10-16(13-20(19)29-2)21(27)25-26-22(28)18-14-17(23-24-18)15-8-6-5-7-9-15/h5-11,13-14H,3-4,12H2,1-2H3,(H,23,24)(H,25,27)(H,26,28) |
| InChIKey | ZJTRUCQIVHVBFE-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 105.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|