C18H23N3O5 — CID 120615160
(2S)-2-[[3-(3,4-dimethoxyphenyl)-1H-pyrazole-5-carbonyl]amino]hexanoic acid (PubChem CID 120615160) has the molecular formula C18H23N3O5 and a molecular weight of 361.40 g/mol. Its IUPAC name is (2S)-2-[[3-(3,4-dimethoxyphenyl)-1H-pyrazole-5-carbonyl]amino]hexanoic acid.
| Compound Name | (2S)-2-[[3-(3,4-dimethoxyphenyl)-1H-pyrazole-5-carbonyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 120615160 |
| Molecular Formula | C18H23N3O5 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | (2S)-2-[[3-(3,4-dimethoxyphenyl)-1H-pyrazole-5-carbonyl]amino]hexanoic acid |
| SMILES | CCCC[C@H](NC(=O)c1cc(-c2ccc(OC)c(OC)c2)n[nH]1)C(=O)O |
| InChI | InChI=1S/C18H23N3O5/c1-4-5-6-12(18(23)24)19-17(22)14-10-13(20-21-14)11-7-8-15(25-2)16(9-11)26-3/h7-10,12H,4-6H2,1-3H3,(H,19,22)(H,20,21)(H,23,24)/t12-/m0/s1 |
| InChIKey | AFIOIRZOOHWAOA-LBPRGKRZSA-N |
| XLogP | 2.47 |
| TPSA | 113.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |