C20H20N4O3 — CID 8889318
N'-[2-(2,6-dimethylphenoxy)acetyl]-3-phenyl-1H-pyrazole-5-carbohydrazide (PubChem CID 8889318) has the molecular formula C20H20N4O3 and a molecular weight of 364.41 g/mol. Its IUPAC name is N'-[2-(2,6-dimethylphenoxy)acetyl]-3-phenyl-1H-pyrazole-5-carbohydrazide.
| Compound Name | N'-[2-(2,6-dimethylphenoxy)acetyl]-3-phenyl-1H-pyrazole-5-carbohydrazide |
|---|---|
| PubChem CID | 8889318 |
| Molecular Formula | C20H20N4O3 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | N'-[2-(2,6-dimethylphenoxy)acetyl]-3-phenyl-1H-pyrazole-5-carbohydrazide |
| SMILES | Cc1cccc(C)c1OCC(=O)NNC(=O)c1cc(-c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C20H20N4O3/c1-13-7-6-8-14(2)19(13)27-12-18(25)23-24-20(26)17-11-16(21-22-17)15-9-4-3-5-10-15/h3-11H,12H2,1-2H3,(H,21,22)(H,23,25)(H,24,26) |
| InChIKey | PTCGOUTXBVZUAE-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|