C17H19N3O4 — CID 9087574
4-acetyl-N'-[2-(2,6-dimethylphenoxy)acetyl]-1H-pyrrole-2-carbohydrazide (PubChem CID 9087574) has the molecular formula C17H19N3O4 and a molecular weight of 329.36 g/mol. Its IUPAC name is 4-acetyl-N'-[2-(2,6-dimethylphenoxy)acetyl]-1H-pyrrole-2-carbohydrazide.
| Compound Name | 4-acetyl-N'-[2-(2,6-dimethylphenoxy)acetyl]-1H-pyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 9087574 |
| Molecular Formula | C17H19N3O4 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 4-acetyl-N'-[2-(2,6-dimethylphenoxy)acetyl]-1H-pyrrole-2-carbohydrazide |
| SMILES | CC(=O)c1c[nH]c(C(=O)NNC(=O)COc2c(C)cccc2C)c1 |
| InChI | InChI=1S/C17H19N3O4/c1-10-5-4-6-11(2)16(10)24-9-15(22)19-20-17(23)14-7-13(8-18-14)12(3)21/h4-8,18H,9H2,1-3H3,(H,19,22)(H,20,23) |
| InChIKey | HFAKKXDVPKRNOA-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 100.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|