C11H16N2O2 — CID 116820679
2-(2,6-dimethylphenoxy)-N'-methylacetohydrazide (PubChem CID 116820679) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is 2-(2,6-dimethylphenoxy)-N'-methylacetohydrazide.
| Compound Name | 2-(2,6-dimethylphenoxy)-N'-methylacetohydrazide |
|---|---|
| PubChem CID | 116820679 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 2-(2,6-dimethylphenoxy)-N'-methylacetohydrazide |
| SMILES | CNNC(=O)COc1c(C)cccc1C |
| InChI | InChI=1S/C11H16N2O2/c1-8-5-4-6-9(2)11(8)15-7-10(14)13-12-3/h4-6,12H,7H2,1-3H3,(H,13,14) |
| InChIKey | LFMLUAYBOOBAFD-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|