C19H20ClN3O4 — CID 24634664
4-chloro-N-[2-[2-[2-(2,6-dimethylphenoxy)acetyl]hydrazinyl]-2-oxoethyl]benzamide (PubChem CID 24634664) has the molecular formula C19H20ClN3O4 and a molecular weight of 389.84 g/mol. Its IUPAC name is 4-chloro-N-[2-[2-[2-(2,6-dimethylphenoxy)acetyl]hydrazinyl]-2-oxoethyl]benzamide.
| Compound Name | 4-chloro-N-[2-[2-[2-(2,6-dimethylphenoxy)acetyl]hydrazinyl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 24634664 |
| Molecular Formula | C19H20ClN3O4 |
| Molecular Weight | 389.84 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | 4-chloro-N-[2-[2-[2-(2,6-dimethylphenoxy)acetyl]hydrazinyl]-2-oxoethyl]benzamide |
| SMILES | Cc1cccc(C)c1OCC(=O)NNC(=O)CNC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H20ClN3O4/c1-12-4-3-5-13(2)18(12)27-11-17(25)23-22-16(24)10-21-19(26)14-6-8-15(20)9-7-14/h3-9H,10-11H2,1-2H3,(H,21,26)(H,22,24)(H,23,25) |
| InChIKey | SGYMDVTZNCSWQW-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.84 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|