C21H27N3O3 — CID 82097491
N-(3-aminopropyl)-4-[[[2-(2,6-dimethylphenoxy)acetyl]amino]methyl]benzamide (PubChem CID 82097491) has the molecular formula C21H27N3O3 and a molecular weight of 369.47 g/mol. Its IUPAC name is N-(3-aminopropyl)-4-[[[2-(2,6-dimethylphenoxy)acetyl]amino]methyl]benzamide.
| Compound Name | N-(3-aminopropyl)-4-[[[2-(2,6-dimethylphenoxy)acetyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 82097491 |
| Molecular Formula | C21H27N3O3 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | N-(3-aminopropyl)-4-[[[2-(2,6-dimethylphenoxy)acetyl]amino]methyl]benzamide |
| SMILES | Cc1cccc(C)c1OCC(=O)NCc1ccc(C(=O)NCCCN)cc1 |
| InChI | InChI=1S/C21H27N3O3/c1-15-5-3-6-16(2)20(15)27-14-19(25)24-13-17-7-9-18(10-8-17)21(26)23-12-4-11-22/h3,5-10H,4,11-14,22H2,1-2H3,(H,23,26)(H,24,25) |
| InChIKey | VLKSQWXBSHJPIQ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|