C22H28N2O4 — CID 171381792
2-(2,6-dimethylphenoxy)-N-[1,1,2,2-tetradeuterio-2-[[2-(2,6-dimethylphenoxy)acetyl]amino]ethyl]acetamide (PubChem CID 171381792) has the molecular formula C22H28N2O4 and a molecular weight of 388.50 g/mol. Its IUPAC name is 2-(2,6-dimethylphenoxy)-N-[1,1,2,2-tetradeuterio-2-[[2-(2,6-dimethylphenoxy)acetyl]amino]ethyl]acetamide.
| Compound Name | 2-(2,6-dimethylphenoxy)-N-[1,1,2,2-tetradeuterio-2-[[2-(2,6-dimethylphenoxy)acetyl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 171381792 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | 2-(2,6-dimethylphenoxy)-N-[1,1,2,2-tetradeuterio-2-[[2-(2,6-dimethylphenoxy)acetyl]amino]ethyl]acetamide |
| SMILES | [2H]C([2H])(NC(=O)COc1c(C)cccc1C)C([2H])([2H])NC(=O)COc1c(C)cccc1C |
| InChI | InChI=1S/C22H28N2O4/c1-15-7-5-8-16(2)21(15)27-13-19(25)23-11-12-24-20(26)14-28-22-17(3)9-6-10-18(22)4/h5-10H,11-14H2,1-4H3,(H,23,25)(H,24,26)/i11D2,12D2 |
| InChIKey | GOACCZVDHZYPTQ-AREBVXNXSA-N |
| XLogP | 2.61 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |