C17H17N3O5 — CID 4503208
N'-[2-(2,6-dimethylphenoxy)acetyl]-4-nitrobenzohydrazide (PubChem CID 4503208) has the molecular formula C17H17N3O5 and a molecular weight of 343.34 g/mol. Its IUPAC name is N'-[2-(2,6-dimethylphenoxy)acetyl]-4-nitrobenzohydrazide.
| Compound Name | N'-[2-(2,6-dimethylphenoxy)acetyl]-4-nitrobenzohydrazide |
|---|---|
| PubChem CID | 4503208 |
| Molecular Formula | C17H17N3O5 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | N'-[2-(2,6-dimethylphenoxy)acetyl]-4-nitrobenzohydrazide |
| SMILES | Cc1cccc(C)c1OCC(=O)NNC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H17N3O5/c1-11-4-3-5-12(2)16(11)25-10-15(21)18-19-17(22)13-6-8-14(9-7-13)20(23)24/h3-9H,10H2,1-2H3,(H,18,21)(H,19,22) |
| InChIKey | OXIFSMBWAFGBNZ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|