C18H17N5O7S — CID 4506057
N-[[[2-(2,6-dimethylphenoxy)acetyl]amino]carbamothioyl]-3,5-dinitrobenzamide (PubChem CID 4506057) has the molecular formula C18H17N5O7S and a molecular weight of 447.43 g/mol. Its IUPAC name is N-[[[2-(2,6-dimethylphenoxy)acetyl]amino]carbamothioyl]-3,5-dinitrobenzamide.
| Compound Name | N-[[[2-(2,6-dimethylphenoxy)acetyl]amino]carbamothioyl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 4506057 |
| Molecular Formula | C18H17N5O7S |
| Molecular Weight | 447.43 g/mol |
| Exact Mass | 447.08 |
| IUPAC Name | N-[[[2-(2,6-dimethylphenoxy)acetyl]amino]carbamothioyl]-3,5-dinitrobenzamide |
| SMILES | Cc1cccc(C)c1OCC(=O)NNC(=S)NC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H17N5O7S/c1-10-4-3-5-11(2)16(10)30-9-15(24)20-21-18(31)19-17(25)12-6-13(22(26)27)8-14(7-12)23(28)29/h3-8H,9H2,1-2H3,(H,20,24)(H2,19,21,25,31) |
| InChIKey | LOZCFEDBMPFIRM-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 165.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.43 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|