C14H19N3O3S — CID 4506058
N-[[[2-(2,6-dimethylphenoxy)acetyl]amino]carbamothioyl]propanamide (PubChem CID 4506058) has the molecular formula C14H19N3O3S and a molecular weight of 309.39 g/mol. Its IUPAC name is N-[[[2-(2,6-dimethylphenoxy)acetyl]amino]carbamothioyl]propanamide.
| Compound Name | N-[[[2-(2,6-dimethylphenoxy)acetyl]amino]carbamothioyl]propanamide |
|---|---|
| PubChem CID | 4506058 |
| Molecular Formula | C14H19N3O3S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | N-[[[2-(2,6-dimethylphenoxy)acetyl]amino]carbamothioyl]propanamide |
| SMILES | CCC(=O)NC(=S)NNC(=O)COc1c(C)cccc1C |
| InChI | InChI=1S/C14H19N3O3S/c1-4-11(18)15-14(21)17-16-12(19)8-20-13-9(2)6-5-7-10(13)3/h5-7H,4,8H2,1-3H3,(H,16,19)(H2,15,17,18,21) |
| InChIKey | LYGVDWZAYADJCO-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|