C18H19N3O3S2 — CID 6132778
(E)-N-[[[2-(2,6-dimethylphenoxy)acetyl]amino]carbamothioyl]-3-thiophen-2-ylprop-2-enamide (PubChem CID 6132778) has the molecular formula C18H19N3O3S2 and a molecular weight of 389.50 g/mol. Its IUPAC name is (E)-N-[[[2-(2,6-dimethylphenoxy)acetyl]amino]carbamothioyl]-3-thiophen-2-ylprop-2-enamide.
| Compound Name | (E)-N-[[[2-(2,6-dimethylphenoxy)acetyl]amino]carbamothioyl]-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 6132778 |
| Molecular Formula | C18H19N3O3S2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | (E)-N-[[[2-(2,6-dimethylphenoxy)acetyl]amino]carbamothioyl]-3-thiophen-2-ylprop-2-enamide |
| SMILES | Cc1cccc(C)c1OCC(=O)NNC(=S)NC(=O)/C=C/c1cccs1 |
| InChI | InChI=1S/C18H19N3O3S2/c1-12-5-3-6-13(2)17(12)24-11-16(23)20-21-18(25)19-15(22)9-8-14-7-4-10-26-14/h3-10H,11H2,1-2H3,(H,20,23)(H2,19,21,22,25)/b9-8+ |
| InChIKey | UBYDNIAOUAKGHB-CMDGGOBGSA-N |
| XLogP | 2.48 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|