C18H19N3O3S2 — CID 5116973
N-[[[2-(4-ethylphenoxy)acetyl]amino]carbamothioyl]-3-thiophen-2-ylprop-2-enamide (PubChem CID 5116973) has the molecular formula C18H19N3O3S2 and a molecular weight of 389.50 g/mol. Its IUPAC name is N-[[[2-(4-ethylphenoxy)acetyl]amino]carbamothioyl]-3-thiophen-2-ylprop-2-enamide.
| Compound Name | N-[[[2-(4-ethylphenoxy)acetyl]amino]carbamothioyl]-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 5116973 |
| Molecular Formula | C18H19N3O3S2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | N-[[[2-(4-ethylphenoxy)acetyl]amino]carbamothioyl]-3-thiophen-2-ylprop-2-enamide |
| SMILES | CCc1ccc(OCC(=O)NNC(=S)NC(=O)C=Cc2cccs2)cc1 |
| InChI | InChI=1S/C18H19N3O3S2/c1-2-13-5-7-14(8-6-13)24-12-17(23)20-21-18(25)19-16(22)10-9-15-4-3-11-26-15/h3-11H,2,12H2,1H3,(H,20,23)(H2,19,21,22,25) |
| InChIKey | NCNHTTVFDZUOHQ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|