C19H20ClN3O3 — CID 34572785
N-[2-[2-[2-(4-chlorophenyl)acetyl]hydrazinyl]-2-oxoethyl]-3,4-dimethylbenzamide (PubChem CID 34572785) has the molecular formula C19H20ClN3O3 and a molecular weight of 373.84 g/mol. Its IUPAC name is N-[2-[2-[2-(4-chlorophenyl)acetyl]hydrazinyl]-2-oxoethyl]-3,4-dimethylbenzamide.
| Compound Name | N-[2-[2-[2-(4-chlorophenyl)acetyl]hydrazinyl]-2-oxoethyl]-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 34572785 |
| Molecular Formula | C19H20ClN3O3 |
| Molecular Weight | 373.84 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | N-[2-[2-[2-(4-chlorophenyl)acetyl]hydrazinyl]-2-oxoethyl]-3,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)NCC(=O)NNC(=O)Cc2ccc(Cl)cc2)cc1C |
| InChI | InChI=1S/C19H20ClN3O3/c1-12-3-6-15(9-13(12)2)19(26)21-11-18(25)23-22-17(24)10-14-4-7-16(20)8-5-14/h3-9H,10-11H2,1-2H3,(H,21,26)(H,22,24)(H,23,25) |
| InChIKey | OUZSKMHHSOHKKQ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.84 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|