C22H26ClN3O4 — CID 24546343
4-chloro-N-[(2S)-1-[2-[2-(2,6-dimethylphenoxy)acetyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide (PubChem CID 24546343) has the molecular formula C22H26ClN3O4 and a molecular weight of 431.92 g/mol. Its IUPAC name is 4-chloro-N-[(2S)-1-[2-[2-(2,6-dimethylphenoxy)acetyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide.
| Compound Name | 4-chloro-N-[(2S)-1-[2-[2-(2,6-dimethylphenoxy)acetyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 24546343 |
| Molecular Formula | C22H26ClN3O4 |
| Molecular Weight | 431.92 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | 4-chloro-N-[(2S)-1-[2-[2-(2,6-dimethylphenoxy)acetyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide |
| SMILES | Cc1cccc(C)c1OCC(=O)NNC(=O)[C@@H](NC(=O)c1ccc(Cl)cc1)C(C)C |
| InChI | InChI=1S/C22H26ClN3O4/c1-13(2)19(24-21(28)16-8-10-17(23)11-9-16)22(29)26-25-18(27)12-30-20-14(3)6-5-7-15(20)4/h5-11,13,19H,12H2,1-4H3,(H,24,28)(H,25,27)(H,26,29)/t19-/m0/s1 |
| InChIKey | OABQHJUDHPKDAW-IBGZPJMESA-N |
| XLogP | 2.94 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.92 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|