C17H20N4O3 — CID 9088365
4-acetyl-N'-[2-(2,4-dimethylanilino)acetyl]-1H-pyrrole-2-carbohydrazide (PubChem CID 9088365) has the molecular formula C17H20N4O3 and a molecular weight of 328.37 g/mol. Its IUPAC name is 4-acetyl-N'-[2-(2,4-dimethylanilino)acetyl]-1H-pyrrole-2-carbohydrazide.
| Compound Name | 4-acetyl-N'-[2-(2,4-dimethylanilino)acetyl]-1H-pyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 9088365 |
| Molecular Formula | C17H20N4O3 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 4-acetyl-N'-[2-(2,4-dimethylanilino)acetyl]-1H-pyrrole-2-carbohydrazide |
| SMILES | CC(=O)c1c[nH]c(C(=O)NNC(=O)CNc2ccc(C)cc2C)c1 |
| InChI | InChI=1S/C17H20N4O3/c1-10-4-5-14(11(2)6-10)19-9-16(23)20-21-17(24)15-7-13(8-18-15)12(3)22/h4-8,18-19H,9H2,1-3H3,(H,20,23)(H,21,24) |
| InChIKey | MNMPILOBWJHAPJ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 103.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|