C22H30N4O2 — CID 56503126
N'-[2-(2,4-dimethylanilino)acetyl]-4-[ethyl(propan-2-yl)amino]benzohydrazide (PubChem CID 56503126) has the molecular formula C22H30N4O2 and a molecular weight of 382.51 g/mol. Its IUPAC name is N'-[2-(2,4-dimethylanilino)acetyl]-4-[ethyl(propan-2-yl)amino]benzohydrazide.
| Compound Name | N'-[2-(2,4-dimethylanilino)acetyl]-4-[ethyl(propan-2-yl)amino]benzohydrazide |
|---|---|
| PubChem CID | 56503126 |
| Molecular Formula | C22H30N4O2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | N'-[2-(2,4-dimethylanilino)acetyl]-4-[ethyl(propan-2-yl)amino]benzohydrazide |
| SMILES | CCN(c1ccc(C(=O)NNC(=O)CNc2ccc(C)cc2C)cc1)C(C)C |
| InChI | InChI=1S/C22H30N4O2/c1-6-26(15(2)3)19-10-8-18(9-11-19)22(28)25-24-21(27)14-23-20-12-7-16(4)13-17(20)5/h7-13,15,23H,6,14H2,1-5H3,(H,24,27)(H,25,28) |
| InChIKey | KWXGWFBGDRMWBA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|