C23H24N4O3 — CID 56503764
N'-[2-(2,4-dimethylanilino)acetyl]-2-phenylmethoxypyridine-4-carbohydrazide (PubChem CID 56503764) has the molecular formula C23H24N4O3 and a molecular weight of 404.47 g/mol. Its IUPAC name is N'-[2-(2,4-dimethylanilino)acetyl]-2-phenylmethoxypyridine-4-carbohydrazide.
| Compound Name | N'-[2-(2,4-dimethylanilino)acetyl]-2-phenylmethoxypyridine-4-carbohydrazide |
|---|---|
| PubChem CID | 56503764 |
| Molecular Formula | C23H24N4O3 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | N'-[2-(2,4-dimethylanilino)acetyl]-2-phenylmethoxypyridine-4-carbohydrazide |
| SMILES | Cc1ccc(NCC(=O)NNC(=O)c2ccnc(OCc3ccccc3)c2)c(C)c1 |
| InChI | InChI=1S/C23H24N4O3/c1-16-8-9-20(17(2)12-16)25-14-21(28)26-27-23(29)19-10-11-24-22(13-19)30-15-18-6-4-3-5-7-18/h3-13,25H,14-15H2,1-2H3,(H,26,28)(H,27,29) |
| InChIKey | PXWFOKGXRYCHJH-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|