C21H22N4O2 — CID 102603450
N'-[2-(2,4-dimethylanilino)acetyl]-2-methylquinoline-4-carbohydrazide (PubChem CID 102603450) has the molecular formula C21H22N4O2 and a molecular weight of 362.43 g/mol. Its IUPAC name is N'-[2-(2,4-dimethylanilino)acetyl]-2-methylquinoline-4-carbohydrazide.
| Compound Name | N'-[2-(2,4-dimethylanilino)acetyl]-2-methylquinoline-4-carbohydrazide |
|---|---|
| PubChem CID | 102603450 |
| Molecular Formula | C21H22N4O2 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | N'-[2-(2,4-dimethylanilino)acetyl]-2-methylquinoline-4-carbohydrazide |
| SMILES | Cc1ccc(NCC(=O)NNC(=O)c2cc(C)nc3ccccc23)c(C)c1 |
| InChI | InChI=1S/C21H22N4O2/c1-13-8-9-18(14(2)10-13)22-12-20(26)24-25-21(27)17-11-15(3)23-19-7-5-4-6-16(17)19/h4-11,22H,12H2,1-3H3,(H,24,26)(H,25,27) |
| InChIKey | HMODZZRGXCEXFP-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|