C19H20N4O3S — CID 9432141
N'-[2-(1,3-benzoxazol-2-ylsulfanyl)acetyl]-2-(2,4-dimethylanilino)acetohydrazide (PubChem CID 9432141) has the molecular formula C19H20N4O3S and a molecular weight of 384.46 g/mol. Its IUPAC name is N'-[2-(1,3-benzoxazol-2-ylsulfanyl)acetyl]-2-(2,4-dimethylanilino)acetohydrazide.
| Compound Name | N'-[2-(1,3-benzoxazol-2-ylsulfanyl)acetyl]-2-(2,4-dimethylanilino)acetohydrazide |
|---|---|
| PubChem CID | 9432141 |
| Molecular Formula | C19H20N4O3S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | N'-[2-(1,3-benzoxazol-2-ylsulfanyl)acetyl]-2-(2,4-dimethylanilino)acetohydrazide |
| SMILES | Cc1ccc(NCC(=O)NNC(=O)CSc2nc3ccccc3o2)c(C)c1 |
| InChI | InChI=1S/C19H20N4O3S/c1-12-7-8-14(13(2)9-12)20-10-17(24)22-23-18(25)11-27-19-21-15-5-3-4-6-16(15)26-19/h3-9,20H,10-11H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | ZQRVPUCMUSMCJO-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|