C16H12BrN3O3S — CID 9340002
N'-[2-(1,3-benzoxazol-2-ylsulfanyl)acetyl]-2-bromobenzohydrazide (PubChem CID 9340002) has the molecular formula C16H12BrN3O3S and a molecular weight of 406.26 g/mol. Its IUPAC name is N'-[2-(1,3-benzoxazol-2-ylsulfanyl)acetyl]-2-bromobenzohydrazide.
| Compound Name | N'-[2-(1,3-benzoxazol-2-ylsulfanyl)acetyl]-2-bromobenzohydrazide |
|---|---|
| PubChem CID | 9340002 |
| Molecular Formula | C16H12BrN3O3S |
| Molecular Weight | 406.26 g/mol |
| Exact Mass | 404.98 |
| IUPAC Name | N'-[2-(1,3-benzoxazol-2-ylsulfanyl)acetyl]-2-bromobenzohydrazide |
| SMILES | O=C(CSc1nc2ccccc2o1)NNC(=O)c1ccccc1Br |
| InChI | InChI=1S/C16H12BrN3O3S/c17-11-6-2-1-5-10(11)15(22)20-19-14(21)9-24-16-18-12-7-3-4-8-13(12)23-16/h1-8H,9H2,(H,19,21)(H,20,22) |
| InChIKey | UPSFLPFDDDWUHU-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.26 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|