C16H14N4O5S — CID 9471435
N-[2-[2-[2-(1,3-benzoxazol-2-ylsulfanyl)acetyl]hydrazinyl]-2-oxoethyl]furan-2-carboxamide (PubChem CID 9471435) has the molecular formula C16H14N4O5S and a molecular weight of 374.38 g/mol. Its IUPAC name is N-[2-[2-[2-(1,3-benzoxazol-2-ylsulfanyl)acetyl]hydrazinyl]-2-oxoethyl]furan-2-carboxamide.
| Compound Name | N-[2-[2-[2-(1,3-benzoxazol-2-ylsulfanyl)acetyl]hydrazinyl]-2-oxoethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 9471435 |
| Molecular Formula | C16H14N4O5S |
| Molecular Weight | 374.38 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | N-[2-[2-[2-(1,3-benzoxazol-2-ylsulfanyl)acetyl]hydrazinyl]-2-oxoethyl]furan-2-carboxamide |
| SMILES | O=C(CNC(=O)c1ccco1)NNC(=O)CSc1nc2ccccc2o1 |
| InChI | InChI=1S/C16H14N4O5S/c21-13(8-17-15(23)12-6-3-7-24-12)19-20-14(22)9-26-16-18-10-4-1-2-5-11(10)25-16/h1-7H,8-9H2,(H,17,23)(H,19,21)(H,20,22) |
| InChIKey | IVZCDYPXRALYSD-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 126.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.38 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|