C23H19N3O3S — CID 9006473
2-[[2-(1,3-benzoxazol-2-ylsulfanyl)acetyl]amino]-N-benzylbenzamide (PubChem CID 9006473) has the molecular formula C23H19N3O3S and a molecular weight of 417.49 g/mol. Its IUPAC name is 2-[[2-(1,3-benzoxazol-2-ylsulfanyl)acetyl]amino]-N-benzylbenzamide.
| Compound Name | 2-[[2-(1,3-benzoxazol-2-ylsulfanyl)acetyl]amino]-N-benzylbenzamide |
|---|---|
| PubChem CID | 9006473 |
| Molecular Formula | C23H19N3O3S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | 2-[[2-(1,3-benzoxazol-2-ylsulfanyl)acetyl]amino]-N-benzylbenzamide |
| SMILES | O=C(CSc1nc2ccccc2o1)Nc1ccccc1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C23H19N3O3S/c27-21(15-30-23-26-19-12-6-7-13-20(19)29-23)25-18-11-5-4-10-17(18)22(28)24-14-16-8-2-1-3-9-16/h1-13H,14-15H2,(H,24,28)(H,25,27) |
| InChIKey | ULUTWFBIWHBGNZ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |