C12H14N2O3S — CID 5128603
2-(1,3-benzoxazol-2-ylsulfanyl)-N-(3-hydroxypropyl)acetamide (PubChem CID 5128603) has the molecular formula C12H14N2O3S and a molecular weight of 266.32 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-ylsulfanyl)-N-(3-hydroxypropyl)acetamide.
| Compound Name | 2-(1,3-benzoxazol-2-ylsulfanyl)-N-(3-hydroxypropyl)acetamide |
|---|---|
| PubChem CID | 5128603 |
| Molecular Formula | C12H14N2O3S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 2-(1,3-benzoxazol-2-ylsulfanyl)-N-(3-hydroxypropyl)acetamide |
| SMILES | O=C(CSc1nc2ccccc2o1)NCCCO |
| InChI | InChI=1S/C12H14N2O3S/c15-7-3-6-13-11(16)8-18-12-14-9-4-1-2-5-10(9)17-12/h1-2,4-5,15H,3,6-8H2,(H,13,16) |
| InChIKey | YCEMLGMYWMJPHC-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|