C11H13NO2S — CID 43510116
4-(1,3-benzoxazol-2-ylsulfanyl)butan-1-ol (PubChem CID 43510116) has the molecular formula C11H13NO2S and a molecular weight of 223.30 g/mol. Its IUPAC name is 4-(1,3-benzoxazol-2-ylsulfanyl)butan-1-ol.
| Compound Name | 4-(1,3-benzoxazol-2-ylsulfanyl)butan-1-ol |
|---|---|
| PubChem CID | 43510116 |
| Molecular Formula | C11H13NO2S |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | 4-(1,3-benzoxazol-2-ylsulfanyl)butan-1-ol |
| SMILES | OCCCCSc1nc2ccccc2o1 |
| InChI | InChI=1S/C11H13NO2S/c13-7-3-4-8-15-11-12-9-5-1-2-6-10(9)14-11/h1-2,5-6,13H,3-4,7-8H2 |
| InChIKey | BODNKTHAVDHBJI-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|