C10H12N2O2S — CID 64805983
2-amino-3-(1,3-benzoxazol-2-ylsulfanyl)propan-1-ol (PubChem CID 64805983) has the molecular formula C10H12N2O2S and a molecular weight of 224.28 g/mol. Its IUPAC name is 2-amino-3-(1,3-benzoxazol-2-ylsulfanyl)propan-1-ol.
| Compound Name | 2-amino-3-(1,3-benzoxazol-2-ylsulfanyl)propan-1-ol |
|---|---|
| PubChem CID | 64805983 |
| Molecular Formula | C10H12N2O2S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 2-amino-3-(1,3-benzoxazol-2-ylsulfanyl)propan-1-ol |
| SMILES | NC(CO)CSc1nc2ccccc2o1 |
| InChI | InChI=1S/C10H12N2O2S/c11-7(5-13)6-15-10-12-8-3-1-2-4-9(8)14-10/h1-4,7,13H,5-6,11H2 |
| InChIKey | WCKJXNDWWUODPY-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |