C11H11N3OS — CID 63054077
2-amino-4-(1,3-benzoxazol-2-ylsulfanyl)butanenitrile (PubChem CID 63054077) has the molecular formula C11H11N3OS and a molecular weight of 233.30 g/mol. Its IUPAC name is 2-amino-4-(1,3-benzoxazol-2-ylsulfanyl)butanenitrile.
| Compound Name | 2-amino-4-(1,3-benzoxazol-2-ylsulfanyl)butanenitrile |
|---|---|
| PubChem CID | 63054077 |
| Molecular Formula | C11H11N3OS |
| Molecular Weight | 233.30 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | 2-amino-4-(1,3-benzoxazol-2-ylsulfanyl)butanenitrile |
| SMILES | N#CC(N)CCSc1nc2ccccc2o1 |
| InChI | InChI=1S/C11H11N3OS/c12-7-8(13)5-6-16-11-14-9-3-1-2-4-10(9)15-11/h1-4,8H,5-6,13H2 |
| InChIKey | FBLXWDSAZPCPKR-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.30 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |