C10H9NO2S — CID 54119103
3-(1,3-benzoxazol-2-ylsulfanyl)propanal (PubChem CID 54119103) has the molecular formula C10H9NO2S and a molecular weight of 207.25 g/mol. Its IUPAC name is 3-(1,3-benzoxazol-2-ylsulfanyl)propanal.
| Compound Name | 3-(1,3-benzoxazol-2-ylsulfanyl)propanal |
|---|---|
| PubChem CID | 54119103 |
| Molecular Formula | C10H9NO2S |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.04 |
| IUPAC Name | 3-(1,3-benzoxazol-2-ylsulfanyl)propanal |
| SMILES | O=CCCSc1nc2ccccc2o1 |
| InChI | InChI=1S/C10H9NO2S/c12-6-3-7-14-10-11-8-4-1-2-5-9(8)13-10/h1-2,4-6H,3,7H2 |
| InChIKey | NMJRQDAECQLMKO-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|