C15H14N2O3S2 — CID 555647
N-[2-(1,3-benzoxazol-2-ylsulfanyl)ethyl]benzenesulfonamide (PubChem CID 555647) has the molecular formula C15H14N2O3S2 and a molecular weight of 334.42 g/mol. Its IUPAC name is N-[2-(1,3-benzoxazol-2-ylsulfanyl)ethyl]benzenesulfonamide.
| Compound Name | N-[2-(1,3-benzoxazol-2-ylsulfanyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 555647 |
| Molecular Formula | C15H14N2O3S2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | N-[2-(1,3-benzoxazol-2-ylsulfanyl)ethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCSc1nc2ccccc2o1)c1ccccc1 |
| InChI | InChI=1S/C15H14N2O3S2/c18-22(19,12-6-2-1-3-7-12)16-10-11-21-15-17-13-8-4-5-9-14(13)20-15/h1-9,16H,10-11H2 |
| InChIKey | GTYXRBCWTYPUKD-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|