C16H23NOS2 — CID 105344726
9-(1,3-benzoxazol-2-ylsulfanyl)nonane-1-thiol (PubChem CID 105344726) has the molecular formula C16H23NOS2 and a molecular weight of 309.50 g/mol. Its IUPAC name is 9-(1,3-benzoxazol-2-ylsulfanyl)nonane-1-thiol.
| Compound Name | 9-(1,3-benzoxazol-2-ylsulfanyl)nonane-1-thiol |
|---|---|
| PubChem CID | 105344726 |
| Molecular Formula | C16H23NOS2 |
| Molecular Weight | 309.50 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 9-(1,3-benzoxazol-2-ylsulfanyl)nonane-1-thiol |
| SMILES | SCCCCCCCCCSc1nc2ccccc2o1 |
| InChI | InChI=1S/C16H23NOS2/c19-12-8-4-2-1-3-5-9-13-20-16-17-14-10-6-7-11-15(14)18-16/h6-7,10-11,19H,1-5,8-9,12-13H2 |
| InChIKey | BWKRERHORPIHSJ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 26.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.50 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|