C10H12N2OS — CID 119085238
1-(1,3-benzoxazol-2-ylsulfanyl)-N,N-dimethylmethanamine (PubChem CID 119085238) has the molecular formula C10H12N2OS and a molecular weight of 208.29 g/mol. Its IUPAC name is 1-(1,3-benzoxazol-2-ylsulfanyl)-N,N-dimethylmethanamine.
| Compound Name | 1-(1,3-benzoxazol-2-ylsulfanyl)-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 119085238 |
| Molecular Formula | C10H12N2OS |
| Molecular Weight | 208.29 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 1-(1,3-benzoxazol-2-ylsulfanyl)-N,N-dimethylmethanamine |
| SMILES | CN(C)CSc1nc2ccccc2o1 |
| InChI | InChI=1S/C10H12N2OS/c1-12(2)7-14-10-11-8-5-3-4-6-9(8)13-10/h3-6H,7H2,1-2H3 |
| InChIKey | GWKLHQSYDBRWRT-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.29 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|