C9H10INOS — CID 69051605
iodomethane;2-methylsulfanyl-1,3-benzoxazole (PubChem CID 69051605) has the molecular formula C9H10INOS and a molecular weight of 307.16 g/mol. Its IUPAC name is iodomethane;2-methylsulfanyl-1,3-benzoxazole.
| Compound Name | iodomethane;2-methylsulfanyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 69051605 |
| Molecular Formula | C9H10INOS |
| Molecular Weight | 307.16 g/mol |
| Exact Mass | 306.95 |
| IUPAC Name | iodomethane;2-methylsulfanyl-1,3-benzoxazole |
| SMILES | CI.CSc1nc2ccccc2o1 |
| InChI | InChI=1S/C8H7NOS.CH3I/c1-11-8-9-6-4-2-3-5-7(6)10-8;1-2/h2-5H,1H3;1H3 |
| InChIKey | MTGVCNMCSIKCNZ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.16 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|