C9H9NO2S — CID 130784427
7-methoxy-2-methylsulfanyl-1,3-benzoxazole (PubChem CID 130784427) has the molecular formula C9H9NO2S and a molecular weight of 195.24 g/mol. Its IUPAC name is 7-methoxy-2-methylsulfanyl-1,3-benzoxazole.
| Compound Name | 7-methoxy-2-methylsulfanyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 130784427 |
| Molecular Formula | C9H9NO2S |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.04 |
| IUPAC Name | 7-methoxy-2-methylsulfanyl-1,3-benzoxazole |
| SMILES | COc1cccc2nc(SC)oc12 |
| InChI | InChI=1S/C9H9NO2S/c1-11-7-5-3-4-6-8(7)12-9(10-6)13-2/h3-5H,1-2H3 |
| InChIKey | VVPABVAIILBVJM-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |