C13H11NO2S — CID 10467053
7-methoxy-2-(5-methylthiophen-2-yl)-1,3-benzoxazole (PubChem CID 10467053) has the molecular formula C13H11NO2S and a molecular weight of 245.30 g/mol. Its IUPAC name is 7-methoxy-2-(5-methylthiophen-2-yl)-1,3-benzoxazole.
| Compound Name | 7-methoxy-2-(5-methylthiophen-2-yl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 10467053 |
| Molecular Formula | C13H11NO2S |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 7-methoxy-2-(5-methylthiophen-2-yl)-1,3-benzoxazole |
| SMILES | COc1cccc2nc(-c3ccc(C)s3)oc12 |
| InChI | InChI=1S/C13H11NO2S/c1-8-6-7-11(17-8)13-14-9-4-3-5-10(15-2)12(9)16-13/h3-7H,1-2H3 |
| InChIKey | VYZYTICTDKOJHU-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |