C17H15NO4S — CID 18074330
(4Z)-4-[(2,3-dimethoxyphenyl)methylidene]-2-(5-methylthiophen-2-yl)-1,3-oxazol-5-one (PubChem CID 18074330) has the molecular formula C17H15NO4S and a molecular weight of 329.38 g/mol. Its IUPAC name is (4Z)-4-[(2,3-dimethoxyphenyl)methylidene]-2-(5-methylthiophen-2-yl)-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[(2,3-dimethoxyphenyl)methylidene]-2-(5-methylthiophen-2-yl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 18074330 |
| Molecular Formula | C17H15NO4S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | (4Z)-4-[(2,3-dimethoxyphenyl)methylidene]-2-(5-methylthiophen-2-yl)-1,3-oxazol-5-one |
| SMILES | COc1cccc(/C=C2\N=C(c3ccc(C)s3)OC2=O)c1OC |
| InChI | InChI=1S/C17H15NO4S/c1-10-7-8-14(23-10)16-18-12(17(19)22-16)9-11-5-4-6-13(20-2)15(11)21-3/h4-9H,1-3H3/b12-9- |
| InChIKey | QVQCNEFKGOMSGV-XFXZXTDPSA-N |
| XLogP | 3.42 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|