C18H17NO5S — CID 18074329
(4Z)-2-(5-methylthiophen-2-yl)-4-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-oxazol-5-one (PubChem CID 18074329) has the molecular formula C18H17NO5S and a molecular weight of 359.40 g/mol. Its IUPAC name is (4Z)-2-(5-methylthiophen-2-yl)-4-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-oxazol-5-one.
| Compound Name | (4Z)-2-(5-methylthiophen-2-yl)-4-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 18074329 |
| Molecular Formula | C18H17NO5S |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | (4Z)-2-(5-methylthiophen-2-yl)-4-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-oxazol-5-one |
| SMILES | COc1cc(/C=C2\N=C(c3ccc(C)s3)OC2=O)cc(OC)c1OC |
| InChI | InChI=1S/C18H17NO5S/c1-10-5-6-15(25-10)17-19-12(18(20)24-17)7-11-8-13(21-2)16(23-4)14(9-11)22-3/h5-9H,1-4H3/b12-7- |
| InChIKey | RDQAWAYKOJIGJJ-GHXNOFRVSA-N |
| XLogP | 3.43 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|