C19H19NO4S — CID 35865177
(4Z)-4-[(3-methoxy-4-propan-2-yloxyphenyl)methylidene]-2-(5-methylthiophen-2-yl)-1,3-oxazol-5-one (PubChem CID 35865177) has the molecular formula C19H19NO4S and a molecular weight of 357.43 g/mol. Its IUPAC name is (4Z)-4-[(3-methoxy-4-propan-2-yloxyphenyl)methylidene]-2-(5-methylthiophen-2-yl)-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[(3-methoxy-4-propan-2-yloxyphenyl)methylidene]-2-(5-methylthiophen-2-yl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 35865177 |
| Molecular Formula | C19H19NO4S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | (4Z)-4-[(3-methoxy-4-propan-2-yloxyphenyl)methylidene]-2-(5-methylthiophen-2-yl)-1,3-oxazol-5-one |
| SMILES | COc1cc(/C=C2\N=C(c3ccc(C)s3)OC2=O)ccc1OC(C)C |
| InChI | InChI=1S/C19H19NO4S/c1-11(2)23-15-7-6-13(10-16(15)22-4)9-14-19(21)24-18(20-14)17-8-5-12(3)25-17/h5-11H,1-4H3/b14-9- |
| InChIKey | OYBSAFAHJKEDJO-ZROIWOOFSA-N |
| XLogP | 4.20 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|