C14H11NO2S2 — CID 2687166
(4Z)-2-(5-methylthiophen-2-yl)-4-[(5-methylthiophen-2-yl)methylidene]-1,3-oxazol-5-one (PubChem CID 2687166) has the molecular formula C14H11NO2S2 and a molecular weight of 289.38 g/mol. Its IUPAC name is (4Z)-2-(5-methylthiophen-2-yl)-4-[(5-methylthiophen-2-yl)methylidene]-1,3-oxazol-5-one.
| Compound Name | (4Z)-2-(5-methylthiophen-2-yl)-4-[(5-methylthiophen-2-yl)methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 2687166 |
| Molecular Formula | C14H11NO2S2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.02 |
| IUPAC Name | (4Z)-2-(5-methylthiophen-2-yl)-4-[(5-methylthiophen-2-yl)methylidene]-1,3-oxazol-5-one |
| SMILES | Cc1ccc(/C=C2\N=C(c3ccc(C)s3)OC2=O)s1 |
| InChI | InChI=1S/C14H11NO2S2/c1-8-3-5-10(18-8)7-11-14(16)17-13(15-11)12-6-4-9(2)19-12/h3-7H,1-2H3/b11-7- |
| InChIKey | YAFMCUZJGLJMRH-XFFZJAGNSA-N |
| XLogP | 3.77 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|