C19H15NO4S — CID 24604452
(4Z)-4-[(7-methoxy-2H-chromen-3-yl)methylidene]-2-(5-methylthiophen-2-yl)-1,3-oxazol-5-one (PubChem CID 24604452) has the molecular formula C19H15NO4S and a molecular weight of 353.40 g/mol. Its IUPAC name is (4Z)-4-[(7-methoxy-2H-chromen-3-yl)methylidene]-2-(5-methylthiophen-2-yl)-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[(7-methoxy-2H-chromen-3-yl)methylidene]-2-(5-methylthiophen-2-yl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 24604452 |
| Molecular Formula | C19H15NO4S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | (4Z)-4-[(7-methoxy-2H-chromen-3-yl)methylidene]-2-(5-methylthiophen-2-yl)-1,3-oxazol-5-one |
| SMILES | COc1ccc2c(c1)OCC(/C=C1\N=C(c3ccc(C)s3)OC1=O)=C2 |
| InChI | InChI=1S/C19H15NO4S/c1-11-3-6-17(25-11)18-20-15(19(21)24-18)8-12-7-13-4-5-14(22-2)9-16(13)23-10-12/h3-9H,10H2,1-2H3/b15-8- |
| InChIKey | OMPVJDCPOAIINH-NVNXTCNLSA-N |
| XLogP | 3.73 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|