C20H14O4 — CID 3359173
2-[(6-methoxy-2H-chromen-3-yl)methylidene]indene-1,3-dione (PubChem CID 3359173) has the molecular formula C20H14O4 and a molecular weight of 318.33 g/mol. Its IUPAC name is 2-[(6-methoxy-2H-chromen-3-yl)methylidene]indene-1,3-dione.
| Compound Name | 2-[(6-methoxy-2H-chromen-3-yl)methylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 3359173 |
| Molecular Formula | C20H14O4 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 2-[(6-methoxy-2H-chromen-3-yl)methylidene]indene-1,3-dione |
| SMILES | COc1ccc2c(c1)C=C(C=C1C(=O)c3ccccc3C1=O)CO2 |
| InChI | InChI=1S/C20H14O4/c1-23-14-6-7-18-13(10-14)8-12(11-24-18)9-17-19(21)15-4-2-3-5-16(15)20(17)22/h2-10H,11H2,1H3 |
| InChIKey | PYRJJQDBXOADKU-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|